EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H12NO |
| Net Charge | +1 |
| Average Mass | 138.190 |
| Monoisotopic Mass | 138.09134 |
| SMILES | [NH3+]CC(O)c1ccccc1 |
| InChI | InChI=1S/C8H11NO/c9-6-8(10)7-4-2-1-3-5-7/h1-5,8,10H,6,9H2/p+1 |
| InChIKey | ULSIYEODSMZIPX-UHFFFAOYSA-O |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (3137238) |
| Roles Classification |
|---|
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| phenylethanolaminium (CHEBI:57741) has role human metabolite (CHEBI:77746) |
| phenylethanolaminium (CHEBI:57741) is a ammonium ion derivative (CHEBI:35274) |
| phenylethanolaminium (CHEBI:57741) is conjugate acid of phenylethanolamine (CHEBI:16343) |
| Incoming Relation(s) |
| phenylethanolamine (CHEBI:16343) is conjugate base of phenylethanolaminium (CHEBI:57741) |
| IUPAC Name |
|---|
| 2-hydroxy-2-phenylethanaminium |
| Synonyms | Source |
|---|---|
| 2-ammonio-1-phenylethanol | ChEBI |
| 2-azaniumyl-1-phenylethanol | ChEBI |
| 2-hydroxy-2-phenylethan-1-aminium | ChEBI |
| phenylethanolaminium cation | ChEBI |
| UniProt Name | Source |
|---|---|
| phenylethanolamine | UniProt |
| Manual Xrefs | Databases |
|---|---|
| PHENYLETHANOLAMINE | MetaCyc |