EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:80944 - tribuloside
| Formula | C30H26O13 |
| Net Charge | 0 |
| Average Mass | 594.525 |
| Monoisotopic Mass | 594.13734 |
| SMILES | O=C(/C=C/c1ccc(O)cc1)OC[C@H]1O[C@@H](Oc2c(-c3ccc(O)cc3)oc3cc(O)cc(O)c3c2=O)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C30H26O13/c31-16-6-1-14(2-7-16)3-10-22(35)40-13-21-24(36)26(38)27(39)30(42-21)43-29-25(37)23-19(34)11-18(33)12-20(23)41-28(29)15-4-8-17(32)9-5-15/h1-12,21,24,26-27,30-34,36,38-39H,13H2/b10-3+/t21-,24-,26+,27-,30+/m1/s1 |
| InChIKey | DVGGLGXQSFURLP-VWMSDXGPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Potentilla multifida (ncbitaxon:210859) | - | PubMed (17504571) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tribuloside (CHEBI:80944) has functional parent trans-4-coumaric acid (CHEBI:32374) |
| tribuloside (CHEBI:80944) has functional parent kaempferol (CHEBI:28499) |
| tribuloside (CHEBI:80944) has role plant metabolite (CHEBI:76924) |
| tribuloside (CHEBI:80944) is a cinnamate ester (CHEBI:36087) |
| tribuloside (CHEBI:80944) is a glycosyloxyflavone (CHEBI:50018) |
| tribuloside (CHEBI:80944) is a monosaccharide derivative (CHEBI:63367) |
| tribuloside (CHEBI:80944) is a trihydroxyflavone (CHEBI:27116) |
| IUPAC Name |
|---|
| 5,7-dihydroxy-2-(4-hydroxyphenyl)-4-oxo-4E-1-benzopyran-3-yl 6-O-[(2E)-3-(4-hydroxyphenyl)prop-2-enoyl]-β-D-glucopyranoside |
| Synonym | Source |
|---|---|
| kaempferol-3-O-β-D-(6''-(E)-p-coumaroyl)-glucopyranoside | ChEBI |
| Citations |
|---|