EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H24 |
| Net Charge | 0 |
| Average Mass | 204.357 |
| Monoisotopic Mass | 204.18780 |
| SMILES | [H][C@@]12C(=C)CC[C@]1([H])[C@H](C)CC[C@@]1([H])C(C)(C)[C@@]21[H] |
| InChI | InChI=1S/C15H24/c1-9-6-8-12-14(15(12,3)4)13-10(2)5-7-11(9)13/h9,11-14H,2,5-8H2,1,3-4H3/t9-,11-,12-,13-,14-/m1/s1 |
| InChIKey | IRCZVRWQUNZGSH-DKTYCGPESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Acorus calamus (ncbitaxon:4465) | - | DOI (10.1080/10412905.2002.9699886) | |
| Eryngium billardierei (ncbitaxon:49862) | aerial part (BTO:0001658) | DOI (10.1080/10412905.2004.9698648) | |
| Ferula communis (ncbitaxon:54829) | flower (BTO:0000469) | DOI (10.1080/10412905.2005.9698861) | Isolated from flower head. |
| Irvingia barteri (IPNI:813759-1) | leaf (BTO:0000713) | PubMed (23413580) | |
| Murraya koenigii (ncbitaxon:159030) | leaf (BTO:0000713) | PubMed (22428264) | |
| Penicillium roqueforti (ncbitaxon:5082) | - | PubMed (12381151) | |
| Pinus heldreichii (ncbitaxon:88729) | - | PubMed (17510986) | |
| Pinus peuce (ncbitaxon:71646) | - | PubMed (18649304) | |
| Salvia leucantha (ncbitaxon:933138) | leaf (BTO:0000713) | PubMed (20614830) | |
| Salvia reuteriana (ncbitaxon:1685715) | - | PubMed (22799099) | |
| Valeriana wallichii (ncbitaxon:59170) | root (BTO:0001188) | DOI (10.1080/10412905.2005.9698945) | |
| Zanthoxylum rugosum (IPNI:776001-1) | root (BTO:0001188) | DOI (10.1080/10412905.1999.9701063) |
| Roles Classification |
|---|
| Biological Roles: | Penicillium metabolite Any fungal metabolite produced during a metabolic reaction in Penicillium. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. volatile oil component Any plant metabolite that is found naturally as a component of a volatile oil. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| β-gurjunene (CHEBI:80940) has role Penicillium metabolite (CHEBI:76964) |
| β-gurjunene (CHEBI:80940) has role plant metabolite (CHEBI:76924) |
| β-gurjunene (CHEBI:80940) has role volatile oil component (CHEBI:27311) |
| β-gurjunene (CHEBI:80940) is a carbotricyclic compound (CHEBI:38032) |
| β-gurjunene (CHEBI:80940) is a sesquiterpene (CHEBI:35189) |
| IUPAC Name |
|---|
| (1aR,4R,4aR,7aR,7bR)-1,1,4-trimethyl-7-methylidenedecahydro-1H-cyclopropa[e]azulene |
| Synonym | Source |
|---|---|
| beta-gurjunene | ChemIDplus |
| UniProt Name | Source |
|---|---|
| β-gurjunene | UniProt |
| Registry Numbers | Sources |
|---|---|
| CAS:73464-47-8 | ChemIDplus |
| Citations |
|---|