EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H9Br2NO3 |
| Net Charge | 0 |
| Average Mass | 338.983 |
| Monoisotopic Mass | 336.89492 |
| SMILES | NC(Cc1cc(Br)c(O)c(Br)c1)C(=O)O |
| InChI | InChI=1S/C9H9Br2NO3/c10-5-1-4(2-6(11)8(5)13)3-7(12)9(14)15/h1-2,7,13H,3,12H2,(H,14,15) |
| InChIKey | COESHZUDRKCEPA-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3,5-Dibromo-tyrosine (CHEBI:80912) is a monocarboxylic acid (CHEBI:25384) |
| Synonym | Source |
|---|---|
| 3,5-Dibromotyrosine | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C17080 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| CAS:537-24-6 | KEGG COMPOUND |