EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H32O7 |
| Net Charge | 0 |
| Average Mass | 432.513 |
| Monoisotopic Mass | 432.21480 |
| SMILES | COc1cc2c(c(OC)c1OC)-c1c(cc(OC)c(OC)c1OC)CC(C)(O)C(C)C2 |
| InChI | InChI=1S/C24H32O7/c1-13-9-14-10-16(26-3)20(28-5)22(30-7)18(14)19-15(12-24(13,2)25)11-17(27-4)21(29-6)23(19)31-8/h10-11,13,25H,9,12H2,1-8H3 |
| InChIKey | YEFOAORQXAOVJQ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | astringent A compound that causes the contraction of body tissues, typically used to reduce bleeding from minor abrasions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Schizandrin (CHEBI:80900) is a tannin (CHEBI:26848) |
| Manual Xrefs | Databases |
|---|---|
| C17064 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| CAS:7432-28-2 | KEGG COMPOUND |