EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H12O6 |
| Net Charge | 0 |
| Average Mass | 300.266 |
| Monoisotopic Mass | 300.06339 |
| SMILES | COc1cc(O)c2c(=O)c(O)c(-c3ccc(O)cc3)oc2c1 |
| InChI | InChI=1S/C16H12O6/c1-21-10-6-11(18)13-12(7-10)22-16(15(20)14(13)19)8-2-4-9(17)5-3-8/h2-7,17-18,20H,1H3 |
| InChIKey | MQSZRBPYXNEFHF-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Alpinia oxyphylla (ncbitaxon:125261) | - | PubMed (25757283) | |
| Oxytropis ochrocephala (ncbitaxon:483875) | - | PubMed (22494026) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| rhamnocitrin (CHEBI:80897) has functional parent kaempferol (CHEBI:28499) |
| rhamnocitrin (CHEBI:80897) has role plant metabolite (CHEBI:76924) |
| rhamnocitrin (CHEBI:80897) is a flavonols (CHEBI:28802) |
| rhamnocitrin (CHEBI:80897) is a monomethoxyflavone (CHEBI:25401) |
| rhamnocitrin (CHEBI:80897) is a trihydroxyflavone (CHEBI:27116) |
| IUPAC Name |
|---|
| 3,5-dihydroxy-2-(4-hydroxyphenyl)-7-methoxy-4H-1-benzopyran-4-one |
| Synonyms | Source |
|---|---|
| 3,4',5-Trihydroxy-7-methoxyflavone | KEGG COMPOUND |
| 7-Methylkaempferol | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C17059 | KEGG COMPOUND |
| LMPK12112589 | LIPID MAPS |
| C00004567 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| Reaxys:41959 | Reaxys |
| CAS:569-92-6 | KEGG COMPOUND |
| CAS:569-92-6 | ChemIDplus |
| Citations |
|---|