EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H15NO4 |
| Net Charge | 0 |
| Average Mass | 177.200 |
| Monoisotopic Mass | 177.10011 |
| SMILES | C[N+](C)(C)C[C@H](O)[C@@H](O)C(=O)[O-] |
| InChI | InChI=1S/C7H15NO4/c1-8(2,3)4-5(9)6(10)7(11)12/h5-6,9-10H,4H2,1-3H3/t5-,6+/m0/s1 |
| InChIKey | ZOPACRMLVDFSGJ-NTSWFWBYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Anthopleurine (CHEBI:80848) is a hydroxy fatty acid (CHEBI:24654) |
| Manual Xrefs | Databases |
|---|---|
| C16994 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| CAS:56595-17-6 | KEGG COMPOUND |