EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H18O11 |
| Net Charge | 0 |
| Average Mass | 422.342 |
| Monoisotopic Mass | 422.08491 |
| SMILES | O=c1c2cc(O)c(O)cc2oc2c([C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)c(O)cc(O)c12 |
| InChI | InChI=1S/C19H18O11/c20-4-11-15(26)16(27)17(28)19(30-11)13-9(24)2-8(23)12-14(25)5-1-6(21)7(22)3-10(5)29-18(12)13/h1-3,11,15-17,19-24,26-28H,4H2/t11-,15-,16+,17-,19+/m1/s1 |
| InChIKey | CDYBOKJASDEORM-HBVDJMOISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cyclopia subternata (ncbitaxon:155109) | - | PubMed (19272608) |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. anti-HSV-1 agent An anti-HSV agent agent that destroys or inhibits the replication of herpes simplex virus-1. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| isomangiferin (CHEBI:80840) has role anti-HSV-1 agent (CHEBI:64953) |
| isomangiferin (CHEBI:80840) has role plant metabolite (CHEBI:76924) |
| isomangiferin (CHEBI:80840) is a C-glycosyl compound (CHEBI:20857) |
| isomangiferin (CHEBI:80840) is a polyphenol (CHEBI:26195) |
| isomangiferin (CHEBI:80840) is a xanthones (CHEBI:51149) |
| IUPAC Name |
|---|
| (1S)-1,5-anhydro-1-(1,3,6,7-tetrahydroxy-9-oxo-9H-xanthen-4-yl)-D-glucitol |
| Manual Xrefs | Databases |
|---|---|
| C00041015 | KNApSAcK |
| C16979 | KEGG COMPOUND |
| HMDB0029477 | HMDB |
| US2011046077 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1444367 | Reaxys |
| CAS:24699-16-9 | KEGG COMPOUND |
| CAS:24699-16-9 | ChemIDplus |
| Citations |
|---|