EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H22O9 |
| Net Charge | 0 |
| Average Mass | 418.398 |
| Monoisotopic Mass | 418.12638 |
| SMILES | O=C(/C=C/c1ccc(O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)cc1)c1ccc(O)cc1O |
| InChI | InChI=1S/C21H22O9/c22-10-17-18(26)19(27)20(28)21(30-17)29-13-5-1-11(2-6-13)3-8-15(24)14-7-4-12(23)9-16(14)25/h1-9,17-23,25-28H,10H2/b8-3+/t17-,18-,19+,20-,21-/m1/s1 |
| InChIKey | YNWXJFQOCHMPCK-LXGDFETPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Glycyrrhiza glabra (ncbitaxon:49827) | - | PubMed (23325115) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| isoliquiritin (CHEBI:80839) has functional parent trans-chalcone (CHEBI:48965) |
| isoliquiritin (CHEBI:80839) has role antineoplastic agent (CHEBI:35610) |
| isoliquiritin (CHEBI:80839) has role plant metabolite (CHEBI:76924) |
| isoliquiritin (CHEBI:80839) is a chalcones (CHEBI:23086) |
| isoliquiritin (CHEBI:80839) is a monosaccharide derivative (CHEBI:63367) |
| isoliquiritin (CHEBI:80839) is a resorcinols (CHEBI:33572) |
| isoliquiritin (CHEBI:80839) is a β-D-glucoside (CHEBI:22798) |
| IUPAC Name |
|---|
| 4-[(1E)-3-(2,4-dihydroxyphenyl)-3-oxoprop-1-en-1-yl]phenyl β-D-glucopyranoside |
| Synonym | Source |
|---|---|
| 4-β-D-glucopyranosyloxy-2',4'-dihydroxy-trans-chalcone | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C16978 | KEGG COMPOUND |
| HMDB0037318 | HMDB |
| LMPK12120021 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:59159 | Reaxys |
| CAS:5041-81-6 | KEGG COMPOUND |
| Citations |
|---|