EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H26N2O3 |
| Net Charge | 0 |
| Average Mass | 366.461 |
| Monoisotopic Mass | 366.19434 |
| SMILES | [H][C@]12C[C@H](/C(=C\OC)C(=O)OC)[C@@H](C=C)CN1CCc1c2nc2ccccc12 |
| InChI | InChI=1S/C22H26N2O3/c1-4-14-12-24-10-9-16-15-7-5-6-8-19(15)23-21(16)20(24)11-17(14)18(13-26-2)22(25)27-3/h4-8,13-14,17,20,23H,1,9-12H2,2-3H3/b18-13+/t14-,17-,20+/m0/s1 |
| InChIKey | TZUGIFAYWNNSAO-AZQGJTAVSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Hirsuteine (CHEBI:80834) is a alkaloid (CHEBI:22315) |
| Manual Xrefs | Databases |
|---|---|
| C16971 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| CAS:35467-43-7 | KEGG COMPOUND |