EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C38H44N2O8 |
| Net Charge | 0 |
| Average Mass | 656.776 |
| Monoisotopic Mass | 656.30977 |
| SMILES | [H][C@]12C=C(OC)C(=O)C[C@]13CCN(C)[C@H]2Cc1c(-c2cc(OC)c(O)c4c2C[C@@H]2N(C)CC[C@]45CC(=O)C(OC)=C[C@]25[H])cc(OC)c(O)c13 |
| InChI | InChI=1S/C38H44N2O8/c1-39-9-7-37-17-27(41)29(45-3)15-23(37)25(39)11-21-19(13-31(47-5)35(43)33(21)37)20-14-32(48-6)36(44)34-22(20)12-26-24-16-30(46-4)28(42)18-38(24,34)8-10-40(26)2/h13-16,23-26,43-44H,7-12,17-18H2,1-6H3/t23-,24-,25+,26+,37-,38-/m1/s1 |
| InChIKey | AXVVWZONCVUAPP-QULPKBGFSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Disinomenine (CHEBI:80819) is a morphinane alkaloid (CHEBI:25418) |
| Synonym | Source |
|---|---|
| Bisinomenine | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C16954 | KEGG COMPOUND |