EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C43H42O22 |
| Net Charge | 0 |
| Average Mass | 910.787 |
| Monoisotopic Mass | 910.21677 |
| SMILES | [H][C@@]1([C@]2(O)C(O)=C(/C=C3/C(=O)C(C(=O)/C=C/c4ccc(O)cc4)=C(O)[C@@](O)([C@]4([H])O[C@H](CO)[C@@H](O)[C@H](O)[C@H]4O)C3=O)C(=O)C(C(=O)/C=C/c3ccc(O)cc3)=C2O)O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C43H42O22/c44-14-24-30(52)32(54)34(56)40(64-24)42(62)36(58)20(28(50)26(38(42)60)22(48)11-5-16-1-7-18(46)8-2-16)13-21-29(51)27(23(49)12-6-17-3-9-19(47)10-4-17)39(61)43(63,37(21)59)41-35(57)33(55)31(53)25(15-45)65-41/h1-13,24-25,30-35,40-41,44-47,52-58,60-63H,14-15H2/b11-5+,12-6+,21-13-/t24-,25-,30-,31-,32+,33+,34-,35-,40-,41-,42+,43-/m1/s1 |
| InChIKey | WLYGSPLCNKYESI-RSUQVHIMSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Carthamin (CHEBI:80810) is a hydroxycinnamic acid (CHEBI:24689) |
| Manual Xrefs | Databases |
|---|---|
| C16941 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| CAS:36338-96-2 | KEGG COMPOUND |