EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H19N3O |
| Net Charge | 0 |
| Average Mass | 281.359 |
| Monoisotopic Mass | 281.15281 |
| SMILES | Cc1ccc(N(CC2=NCCN2)c2cccc(O)c2)cc1 |
| InChI | InChI=1S/C17H19N3O/c1-13-5-7-14(8-6-13)20(12-17-18-9-10-19-17)15-3-2-4-16(21)11-15/h2-8,11,21H,9-10,12H2,1H3,(H,18,19) |
| InChIKey | MRBDMNSDAVCSSF-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | anti-obesity agent Any substance which is used to reduce or control weight. alpha-adrenergic antagonist An agent that binds to but does not activate α-adrenergic receptors thereby blocking the actions of endogenous or exogenous α-adrenergic agonists. α-Adrenergic antagonists are used in the treatment of hypertension, vasospasm, peripheral vascular disease, shock, and pheochromocytoma. |
| Applications: | alpha-adrenergic antagonist An agent that binds to but does not activate α-adrenergic receptors thereby blocking the actions of endogenous or exogenous α-adrenergic agonists. α-Adrenergic antagonists are used in the treatment of hypertension, vasospasm, peripheral vascular disease, shock, and pheochromocytoma. cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. ophthalmology drug Any compound used for the treatment of eye conditions or eye diseases. vasodilator agent A drug used to cause dilation of the blood vessels. hyperglycemic agent A drug which increases the blood glucose level. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| phentolamine (CHEBI:8081) has role anti-obesity agent (CHEBI:74518) |
| phentolamine (CHEBI:8081) has role cardiovascular drug (CHEBI:35554) |
| phentolamine (CHEBI:8081) has role hyperglycemic agent (CHEBI:76916) |
| phentolamine (CHEBI:8081) has role ophthalmology drug (CHEBI:66981) |
| phentolamine (CHEBI:8081) has role vasodilator agent (CHEBI:35620) |
| phentolamine (CHEBI:8081) has role α-adrenergic antagonist (CHEBI:37890) |
| phentolamine (CHEBI:8081) is a imidazoles (CHEBI:24780) |
| phentolamine (CHEBI:8081) is a phenols (CHEBI:33853) |
| phentolamine (CHEBI:8081) is a substituted aniline (CHEBI:48975) |
| phentolamine (CHEBI:8081) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| 3-[(4,5-dihydro-1H-imidazol-2-ylmethyl)(4-methylphenyl)amino]phenol |
| INNs | Source |
|---|---|
| fentolamina | ChemIDplus |
| phentolamine | ChemIDplus |
| phentolamine | WHO MedNet |
| phentolaminum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 2-(N-(m-hydroxyphenyl)-p-toluidinomethyl)imidazoline | ChemIDplus |
| Phentolamin | ChEMBL |
| Phentolamine mesylate | KEGG COMPOUND |
| Brand Names | Source |
|---|---|
| Regitina | ChEBI |
| Regitine | ChemIDplus |
| Rogitine | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 2142 | DrugCentral |
| D00509 | KEGG DRUG |
| D08362 | KEGG DRUG |
| DB00692 | DrugBank |
| HMDB0014830 | HMDB |
| LSM-4022 | LINCS |
| Phentolamine | Wikipedia |
| US2503059 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:272944 | Reaxys |
| CAS:50-60-2 | ChemIDplus |
| Citations |
|---|