EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H19N3O |
| Net Charge | 0 |
| Average Mass | 281.359 |
| Monoisotopic Mass | 281.15281 |
| SMILES | Cc1ccc(N(CC2=NCCN2)c2cccc(O)c2)cc1 |
| InChI | InChI=1S/C17H19N3O/c1-13-5-7-14(8-6-13)20(12-17-18-9-10-19-17)15-3-2-4-16(21)11-15/h2-8,11,21H,9-10,12H2,1H3,(H,18,19) |
| InChIKey | MRBDMNSDAVCSSF-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | alpha-adrenergic antagonist An agent that binds to but does not activate α-adrenergic receptors thereby blocking the actions of endogenous or exogenous α-adrenergic agonists. α-Adrenergic antagonists are used in the treatment of hypertension, vasospasm, peripheral vascular disease, shock, and pheochromocytoma. |
| Applications: | vasodilator agent A drug used to cause dilation of the blood vessels. alpha-adrenergic antagonist An agent that binds to but does not activate α-adrenergic receptors thereby blocking the actions of endogenous or exogenous α-adrenergic agonists. α-Adrenergic antagonists are used in the treatment of hypertension, vasospasm, peripheral vascular disease, shock, and pheochromocytoma. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| phentolamine (CHEBI:8081) has role vasodilator agent (CHEBI:35620) |
| phentolamine (CHEBI:8081) has role α-adrenergic antagonist (CHEBI:37890) |
| phentolamine (CHEBI:8081) is a imidazoles (CHEBI:24780) |
| phentolamine (CHEBI:8081) is a phenols (CHEBI:33853) |
| phentolamine (CHEBI:8081) is a substituted aniline (CHEBI:48975) |
| phentolamine (CHEBI:8081) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| 3-[(4,5-dihydro-1H-imidazol-2-ylmethyl)(4-methylphenyl)amino]phenol |
| INNs | Source |
|---|---|
| phentolaminum | ChemIDplus |
| phentolamine | ChemIDplus |
| fentolamina | ChemIDplus |
| phentolamine | WHO MedNet |
| Synonyms | Source |
|---|---|
| Phentolamine mesylate | KEGG COMPOUND |
| 2-(N-(m-hydroxyphenyl)-p-toluidinomethyl)imidazoline | ChemIDplus |
| Brand Names | Source |
|---|---|
| Regitine | ChemIDplus |
| Rogitine | ChEBI |
| Regitina | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| D08362 | KEGG DRUG |
| DB00692 | DrugBank |
| HMDB0014830 | HMDB |
| Phentolamine | Wikipedia |
| US2503059 | Patent |
| D00509 | KEGG DRUG |
| LSM-4022 | LINCS |
| 2142 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| Reaxys:272944 | Reaxys |
| CAS:50-60-2 | ChemIDplus |
| Citations |
|---|