EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H24ClNO6 |
| Net Charge | 0 |
| Average Mass | 397.855 |
| Monoisotopic Mass | 397.12922 |
| SMILES | COC1=CC(=O)[C@@]2([C@@H]1O)[C@@H](Cl)C[C@@]13C(OC)=C(OC)C(=O)C[C@@]21CCN3C |
| InChI | InChI=1S/C19H24ClNO6/c1-21-6-5-17-8-10(22)14(26-3)16(27-4)18(17,21)9-12(20)19(17)13(23)7-11(25-2)15(19)24/h7,12,15,24H,5-6,8-9H2,1-4H3/t12-,15+,17+,18+,19+/m0/s1 |
| InChIKey | FSXRARBVZZKCGJ-FMAJMWNWSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Acutumine (CHEBI:80789) is a alkaloid (CHEBI:22315) |
| Manual Xrefs | Databases |
|---|---|
| C16910 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| CAS:17088-50-5 | KEGG COMPOUND |