EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H18O |
| Net Charge | 0 |
| Average Mass | 154.253 |
| Monoisotopic Mass | 154.13577 |
| SMILES | CC(C)[C@]12CC[C@](C)(CC1)O2 |
| InChI | InChI=1S/C10H18O/c1-8(2)10-6-4-9(3,11-10)5-7-10/h8H,4-7H2,1-3H3/t9-,10+ |
| InChIKey | RFFOTVCVTJUTAD-AOOOYVTPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Alpinia speciosa (ncbitaxon:188493) | - | PubMed (Nippon Kogaku Zasshi, 91, (1970), 762) | |
| Cannabis sativa (ncbitaxon:3483) | - | Article (Nippon Kogaku Zasshi, 91, (1970), 762) | |
| Chimonanthus zhejiangensis (ncbitaxon:262280) | - | PubMed (20681305) | |
| Piper cubeba (ncbitaxon:405322) | - | Article (Nippon Kogaku Zasshi, 91, (1970), 762) | |
| Polygonum hydropiper (ncbitaxon:46901) | - | PubMed (Nippon Kogaku Zasshi, 91, (1970), 762) | |
| Thymus vulgaris L. (ncbitaxon:49992) | - | PubMed (21707257) |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. volatile oil component Any plant metabolite that is found naturally as a component of a volatile oil. |
| Applications: | central nervous system depressant A loosely defined group of drugs that tend to reduce the activity of the central nervous system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1,4-cineole (CHEBI:80788) has role central nervous system depressant (CHEBI:35488) |
| 1,4-cineole (CHEBI:80788) has role fumigant insecticide (CHEBI:39277) |
| 1,4-cineole (CHEBI:80788) has role plant metabolite (CHEBI:76924) |
| 1,4-cineole (CHEBI:80788) is a cineole (CHEBI:23243) |
| 1,4-cineole (CHEBI:80788) is a oxabicycloalkane (CHEBI:46733) |
| IUPAC Name |
|---|
| 1-methyl-4-(propan-2-yl)-7-oxabicyclo[2.2.1]heptane |
| Synonyms | Source |
|---|---|
| 1,4-Cineol | NIST Chemistry WebBook |
| 1,4-Epoxy-p-menthane | ChemIDplus |
| (1s,4s)-1-methyl-4-(propan-2-yl)-7-oxabicyclo[2.2.1]heptane | IUPAC |
| 1-Isopropyl-4-methyl-7-oxabicyclo(2.2.1)heptane | HMDB |
| 1-Methyl-4-(1-methylethyl)-7-oxabicyclo[2.2.1]heptane | HMDB |
| Isocineole | HMDB |
| UniProt Name | Source |
|---|---|
| 1,4-cineole | UniProt |
| Citations |
|---|