EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H12N2 |
| Net Charge | 0 |
| Average Mass | 160.220 |
| Monoisotopic Mass | 160.10005 |
| SMILES | c1cncc(C2=NCCCC2)c1 |
| InChI | InChI=1S/C10H12N2/c1-2-7-12-10(5-1)9-4-3-6-11-8-9/h3-4,6,8H,1-2,5,7H2 |
| InChIKey | AUBPMADJYNSPOA-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Anabaseine (CHEBI:80787) has role antipsychotic agent (CHEBI:35476) |
| Anabaseine (CHEBI:80787) is a bipyridines (CHEBI:50511) |
| Synonym | Source |
|---|---|
| Anabaseine | ChEMBL |
| Citations |
|---|