EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H22ClNO.HCl |
| Net Charge | 0 |
| Average Mass | 340.294 |
| Monoisotopic Mass | 339.11567 |
| SMILES | CC(COc1ccccc1)N(CCCl)Cc1ccccc1.Cl |
| InChI | InChI=1S/C18H22ClNO.ClH/c1-16(15-21-18-10-6-3-7-11-18)20(13-12-19)14-17-8-4-2-5-9-17;/h2-11,16H,12-15H2,1H3;1H |
| InChIKey | VBCPVIWPDJVHAN-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Phenoxybenzamine hydrochloride (CHEBI:8078) has role antineoplastic agent (CHEBI:35610) |
| Phenoxybenzamine hydrochloride (CHEBI:8078) is a organic molecular entity (CHEBI:50860) |
| Synonyms | Source |
|---|---|
| Dibenzylin | ChEMBL |
| Dibenzyline chloride | ChEMBL |
| Dibenzyline hydrochloride | ChEMBL |
| Dibenzyline (TN) | KEGG COMPOUND |
| Dibenzyran | ChEMBL |
| NSC-37448 | ChEMBL |
| Citations |
|---|