EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H22ClNO |
| Net Charge | 0 |
| Average Mass | 303.833 |
| Monoisotopic Mass | 303.13899 |
| SMILES | CC(COc1ccccc1)N(CCCl)Cc1ccccc1 |
| InChI | InChI=1S/C18H22ClNO/c1-16(15-21-18-10-6-3-7-11-18)20(13-12-19)14-17-8-4-2-5-9-17/h2-11,16H,12-15H2,1H3 |
| InChIKey | QZVCTJOXCFMACW-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Phenoxybenzamine (CHEBI:8077) has role antineoplastic agent (CHEBI:35610) |
| Phenoxybenzamine (CHEBI:8077) has role cardiovascular drug (CHEBI:35554) |
| Phenoxybenzamine (CHEBI:8077) is a aromatic amine (CHEBI:33860) |
| INN | Source |
|---|---|
| fenoxibenzamina | WHO MedNet |
| Synonyms | Source |
|---|---|
| Bensylyt | ChEMBL |
| Benzylyt | ChEMBL |
| dibenylin | DrugCentral |
| dibenyline | DrugCentral |
| dibenzyline | DrugCentral |
| Phenoxybenzamine | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| 2136 | DrugCentral |
| C07435 | KEGG COMPOUND |
| D08358 | KEGG DRUG |
| HMDB0015061 | HMDB |
| LSM-1729 | LINCS |
| Registry Numbers | Sources |
|---|---|
| CAS:59-96-1 | KEGG COMPOUND |
| Citations |
|---|