EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H17N7O9S |
| Net Charge | 0 |
| Average Mass | 411.353 |
| Monoisotopic Mass | 411.08085 |
| SMILES | [H][C@@]12NC(=N)N[C@]13N(C[C@@H](OS(=O)(=O)O)C3(O)O)C(=N)N(O)[C@H]2COC(N)=O |
| InChI | InChI=1S/C10H17N7O9S/c11-6-14-5-3(2-25-8(13)18)17(21)7(12)16-1-4(26-27(22,23)24)10(19,20)9(5,16)15-6/h3-5,12,19-21H,1-2H2,(H2,13,18)(H3,11,14,15)(H,22,23,24)/t3-,4+,5-,9-/m0/s1 |
| InChIKey | CETRDCWBMBILAL-XXKOCQOQSA-N |
| Roles Classification |
|---|
| Biological Roles: | marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. sodium channel blocker An agent that inhibits sodium influx through cell membranes. toxin Poisonous substance produced by a biological organism such as a microbe, animal or plant. neurotoxin A poison that interferes with the functions of the nervous system. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Gonyautoxin 1 (CHEBI:80768) has role marine metabolite (CHEBI:76507) |
| Gonyautoxin 1 (CHEBI:80768) is a organic heterotricyclic compound (CHEBI:26979) |
| Gonyautoxin 1 (CHEBI:80768) is a paralytic shellfish toxin (CHEBI:167564) |
| Manual Xrefs | Databases |
|---|---|
| C16855 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| CAS:60748-39-2 | KEGG COMPOUND |