EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H10N2O6S |
| Net Charge | 0 |
| Average Mass | 238.221 |
| Monoisotopic Mass | 238.02596 |
| SMILES | CO[C@]1(NC(C)=O)CN(S(=O)(=O)O)C1=O |
| InChI | InChI=1S/C6H10N2O6S/c1-4(9)7-6(14-2)3-8(5(6)10)15(11,12)13/h3H2,1-2H3,(H,7,9)(H,11,12,13)/t6-/m1/s1 |
| InChIKey | RFAUYXHDQGJQSD-ZCFIWIBFSA-N |
| Roles Classification |
|---|
| Biological Role: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| SQ 26180 (CHEBI:80766) is a monobactam (CHEBI:50695) |
| Manual Xrefs | Databases |
|---|---|
| C16842 | KEGG COMPOUND |