EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H12BrN3 |
| Net Charge | 0 |
| Average Mass | 314.186 |
| Monoisotopic Mass | 313.02146 |
| SMILES | Brc1ccc2c(c1)nc1c(C3=NCCC3)nccc12 |
| InChI | InChI=1S/C15H12BrN3/c16-9-3-4-10-11-5-7-18-15(12-2-1-6-17-12)14(11)19-13(10)8-9/h3-5,7-8,19H,1-2,6H2 |
| InChIKey | NHZZFYFNMOVHSJ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Eudistomin G (CHEBI:80764) is a harmala alkaloid (CHEBI:61379) |
| Manual Xrefs | Databases |
|---|---|
| C16840 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| CAS:88704-43-2 | KEGG COMPOUND |