EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H17N3O4 |
| Net Charge | 0 |
| Average Mass | 363.373 |
| Monoisotopic Mass | 363.12191 |
| SMILES | CC[C@@]1(O)C(=O)OCc2c1cc1n(c2=O)Cc2cc3c(N)cccc3nc2-1 |
| InChI | InChI=1S/C20H17N3O4/c1-2-20(26)13-7-16-17-10(6-11-14(21)4-3-5-15(11)22-17)8-23(16)18(24)12(13)9-27-19(20)25/h3-7,26H,2,8-9,21H2,1H3/t20-/m0/s1 |
| InChIKey | FUXVKZWTXQUGMW-FQEVSTJZSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 9-Aminocamptothecin (CHEBI:80755) has role antineoplastic agent (CHEBI:35610) |
| 9-Aminocamptothecin (CHEBI:80755) is a pyranoindolizinoquinoline (CHEBI:48626) |
| Synonyms | Source |
|---|---|
| 9-amino-20(s)-camptothecin | ChEMBL |
| 9-aminocamptothecin | ChEMBL |
| Aminocamptothecin | ChEMBL |
| NSC-603071 | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| C16822 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| CAS:91421-43-1 | KEGG COMPOUND |
| Citations |
|---|