EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H7NOS |
| Net Charge | 0 |
| Average Mass | 129.184 |
| Monoisotopic Mass | 129.02483 |
| SMILES | [H][C@]1(C=C)CNC(=S)O1 |
| InChI | InChI=1S/C5H7NOS/c1-2-4-3-6-5(8)7-4/h2,4H,1,3H2,(H,6,8)/t4-/m0/s1 |
| InChIKey | UZQVYLOFLQICCT-BYPYZUCNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Isatis tinctoria (ncbitaxon:161756) | Root (BTO:0001188) | PubMed (31918015) |
| Roles Classification |
|---|
| Biological Roles: | antithyroid drug A drug used to treat hyperthyroidism by reducing the excessive production of thyroid hormones. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. antiviral agent A substance that destroys or inhibits replication of viruses. |
| Application: | antithyroid drug A drug used to treat hyperthyroidism by reducing the excessive production of thyroid hormones. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-goitrin (CHEBI:80751) has role antithyroid drug (CHEBI:50671) |
| (S)-goitrin (CHEBI:80751) has role antiviral agent (CHEBI:22587) |
| (S)-goitrin (CHEBI:80751) has role plant metabolite (CHEBI:76924) |
| (S)-goitrin (CHEBI:80751) is a 5-ethenyl-1,3-oxazolidine-2-thione (CHEBI:183227) |
| (S)-goitrin (CHEBI:80751) is enantiomer of (R)-goitrin (CHEBI:183228) |
| Incoming Relation(s) |
| (RS)-goitrin (CHEBI:183226) has part (S)-goitrin (CHEBI:80751) |
| (R)-goitrin (CHEBI:183228) is enantiomer of (S)-goitrin (CHEBI:80751) |
| IUPAC Name |
|---|
| (5S)-5-ethenyl-1,3-oxazolidine-2-thione |
| Synonyms | Source |
|---|---|
| (5S)-5-ethenyl-2-oxazolidinethione | ChEBI |
| (−)-5-vinyl-2-oxazolidinethione | ChemIDplus |
| goitrin | ChemIDplus |
| (S)-5-ethenyl-2-oxazolidinethione | ChemIDplus |
| (S)-5-vinyloxazolidine-2-thione | ChEBI |
| (S)-(−)-goitrin | ChEBI |
| UniProt Name | Source |
|---|---|
| goitrin | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 5885349 | ChemSpider |
| C16817 | KEGG COMPOUND |
| CN101445490 | Patent |
| CN101863850 | Patent |
| Registry Numbers | Sources |
|---|---|
| CAS:500-12-9 | ChemIDplus |
| Citations |
|---|