EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H24 |
| Net Charge | 0 |
| Average Mass | 204.357 |
| Monoisotopic Mass | 204.18780 |
| SMILES | [H][C@@]12CCC(C)=C[C@@]1([H])[C@H](C(C)C)CC=C2C |
| InChI | InChI=1S/C15H24/c1-10(2)13-8-6-12(4)14-7-5-11(3)9-15(13)14/h6,9-10,13-15H,5,7-8H2,1-4H3/t13-,14-,15-/m0/s1 |
| InChIKey | QMAYBMKBYCGXDH-KKUMJFAQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Astragalus microcephalus (ncbitaxon:1960787) | aerial part (BTO:0001658) | DOI (10.1080/10412905.2006.9699392) | |
| Baccharoides lilacina (IPNI:20008441-1) | aerial part (BTO:0001658) | PubMed (23678821) | |
| Cistus creticus (ncbitaxon:191224) | leaf (BTO:0000713) | PubMed (9342956) | |
| Dryopteris fragrans (ncbitaxon:239565) | - | PubMed (16913486) | |
| Gynura cusimbua (ncbitaxon:1535311) | aerial part (BTO:0001658) | DOI (10.1080/10412905.2007.9699219) | |
| Litsea paludosa (IPNI:465919-1) | - | DOI (10.1080/10412905.2005.9698919) | |
| Melissa officinalis (ncbitaxon:39338) | - | PubMed (34356313) | |
| Pinus heldreichii (ncbitaxon:88729) | - | PubMed (17510986) | |
| Pinus sylvestris (ncbitaxon:3349) | - | PubMed (18372084) |
| Roles Classification |
|---|
| Biological Roles: | volatile oil component Any plant metabolite that is found naturally as a component of a volatile oil. volatile oil component Any plant metabolite that is found naturally as a component of a volatile oil. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| α-cadinene (CHEBI:80749) has role volatile oil component (CHEBI:27311) |
| α-cadinene (CHEBI:80749) is a cadinene (CHEBI:22976) |
| α-cadinene (CHEBI:80749) is a hexahydronaphthalenes (CHEBI:142348) |
| IUPAC Name |
|---|
| (1S,4aR,8aR)-4,7-dimethyl-1-(propan-2-yl)-1,2,4a,5,6,8a-hexahydronaphthalene |
| Synonyms | Source |
|---|---|
| (1S,4aR,8aR)-1,2,4a,5,6,8a-hexahydro-4,7-dimethyl-1-(1-methylethyl)naphthalene | ChEBI |
| (−)-cadina-4,9-diene | ChemIDplus |
| (−)-α-cadinene | ChemIDplus |
| UniProt Name | Source |
|---|---|
| α-cadinene | UniProt |
| Registry Numbers | Sources |
|---|---|
| CAS:11044-40-9 | ChemIDplus |
| CAS:24406-05-1 | NIST Chemistry WebBook |
| CAS:24406-05-1 | ChemIDplus |
| Citations |
|---|