EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H22O10 |
| Net Charge | 0 |
| Average Mass | 482.441 |
| Monoisotopic Mass | 482.12130 |
| SMILES | COc1cc(C2Oc3ccc([C@H]4Oc5cc(O)cc(O)c5C(=O)[C@@H]4O)cc3OC2CO)ccc1O |
| InChI | InChI=1S/C25H22O10/c1-32-17-6-11(2-4-14(17)28)24-20(10-26)33-18-7-12(3-5-16(18)34-24)25-23(31)22(30)21-15(29)8-13(27)9-19(21)35-25/h2-9,20,23-29,31H,10H2,1H3/t20?,23-,24?,25+/m0/s1 |
| InChIKey | FDQAOULAVFHKBX-DBMPWETRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Silybum marianum (ncbitaxon:92921) | - | PubMed (24456525) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| isosilybin (CHEBI:80744) has role plant metabolite (CHEBI:76924) |
| isosilybin (CHEBI:80744) is a flavonolignan (CHEBI:72709) |
| isosilybin (CHEBI:80744) is a guaiacols (CHEBI:134251) |
| isosilybin (CHEBI:80744) is a polyphenol (CHEBI:26195) |
| isosilybin (CHEBI:80744) is a secondary α-hydroxy ketone (CHEBI:2468) |
| IUPAC Name |
|---|
| (2R,3R)-3,5,7-trihydroxy-2-[2-(4-hydroxy-3-methoxyphenyl)-3-(hydroxymethyl)-2,3-dihydro-1,4-benzodioxin-6-yl]-2,3-dihydro-4H-1-benzopyran-4-one |
| Manual Xrefs | Databases |
|---|---|
| C00008662 | KNApSAcK |
| C16808 | KEGG COMPOUND |
| HMDB0033322 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8952975 | Reaxys |
| CAS:72581-71-6 | KEGG COMPOUND |
| Citations |
|---|