EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C42H40O19 |
| Net Charge | 0 |
| Average Mass | 848.763 |
| Monoisotopic Mass | 848.21638 |
| SMILES | [H][C@]1([C@@]2([H])c3cc(C(=O)O)cc(O)c3C(=O)c3c(O[C@@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@H]4O)cccc32)c2cc(CO)cc(O)c2C(=O)c2c(O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)cccc21 |
| InChI | InChI=1S/C42H40O19/c43-11-14-7-18-26(16-3-1-5-22(30(16)34(50)28(18)20(46)8-14)58-41-38(54)36(52)32(48)24(12-44)60-41)27-17-4-2-6-23(59-42-39(55)37(53)33(49)25(13-45)61-42)31(17)35(51)29-19(27)9-15(40(56)57)10-21(29)47/h1-10,24-27,32-33,36-39,41-49,52-55H,11-13H2,(H,56,57)/t24-,25-,26-,27-,32-,33-,36+,37+,38-,39-,41-,42-/m1/s1 |
| InChIKey | ZFWOUNNKSHIAFK-RDAFFBQNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Rheum rhabarbarum (ncbitaxon:333310) | - | Article (Chem. Pharm. Bull., 1974, v22(4), 823-831.) |
| Roles Classification |
|---|
| Biological Roles: | cathartic Any substance that accelerates defecation. Compare with laxatives, which are substances that ease defecation (usually by softening faeces). A substance can be both a laxative and a cathartic. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | laxative An agent that produces a soft formed stool, and relaxes and loosens the bowels, typically used over a protracted period, to relieve constipation. Compare with cathartic, which is a substance that accelerates defecation. A substances can be both a laxative and a cathartic. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sennoside C (CHEBI:80734) is a sennosides (CHEBI:84154) |
| Synonym | Source |
|---|---|
| Sennidin C | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C16797 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| CAS:37271-16-2 | KEGG COMPOUND |