EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H25NO4 |
| Net Charge | 0 |
| Average Mass | 319.401 |
| Monoisotopic Mass | 319.17836 |
| SMILES | [H][C@]12C[C@@H](CC)C=C(C(=O)N[C@@]3(C(=O)O)C[C@@H]3CC)[C@@]1([H])CCC2=O |
| InChI | InChI=1S/C18H25NO4/c1-3-10-7-13-12(5-6-15(13)20)14(8-10)16(21)19-18(17(22)23)9-11(18)4-2/h8,10-13H,3-7,9H2,1-2H3,(H,19,21)(H,22,23)/t10-,11+,12+,13+,18+/m1/s1 |
| InChIKey | FMGBNISRFNDECK-CZSBRECXSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Coronatine (CHEBI:80730) is a N-acyl-amino acid (CHEBI:51569) |