EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H47BrO10 |
| Net Charge | 0 |
| Average Mass | 671.622 |
| Monoisotopic Mass | 670.23526 |
| SMILES | [H][C@]1([C@@H](C)CC[C@H](OC)c2cc(O)ccc2Br)O[C@@]23CC(OC(=O)C[C@]([H])([C@@H](C)O)OC(=O)C[C@](O)(O2)[C@H](C)CC3(C)C)[C@@H]1C |
| InChI | InChI=1S/C32H47BrO10/c1-17(8-11-24(39-7)22-12-21(35)9-10-23(22)33)29-19(3)26-15-32(42-29)30(5,6)14-18(2)31(38,43-32)16-28(37)40-25(20(4)34)13-27(36)41-26/h9-10,12,17-20,24-26,29,34-35,38H,8,11,13-16H2,1-7H3/t17-,18+,19-,20+,24-,25+,26?,29+,31-,32-/m0/s1 |
| InChIKey | RHJPBGWFGOAEID-FAXOFGCBSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Gracilaria coronopifolia (ncbitaxon:439548) | - | PubMed (8843576) | |
| Lyngbya majuscula (ncbitaxon:158786) | - | PubMed (3924698) | |
| Moorea producens (ncbitaxon:1155739) | - | PubMed (25421266) | |
| Stylocheilus longicauda (ncbitaxon:114761) | - | PubMed (4833645) | |
| Trichodesmium erythraeum (ncbitaxon:1206) | - | PubMed (24394406) |
| Roles Classification |
|---|
| Biological Roles: | marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. cyanotoxin Any toxin produced by cyanobacteria (blue-green algae). protein kinase C agonist An agonist that selectively binds to and activates a protein kinase C receptor algal metabolite Any eukaryotic metabolite produced during a metabolic reaction in algae including unicellular organisms like chlorella and diatoms to multicellular organisms like giant kelps and brown algae. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| aplysiatoxin (CHEBI:80716) has role algal metabolite (CHEBI:84735) |
| aplysiatoxin (CHEBI:80716) has role carcinogenic agent (CHEBI:50903) |
| aplysiatoxin (CHEBI:80716) has role cyanotoxin (CHEBI:88048) |
| aplysiatoxin (CHEBI:80716) has role marine metabolite (CHEBI:76507) |
| aplysiatoxin (CHEBI:80716) has role protein kinase C agonist (CHEBI:64018) |
| aplysiatoxin (CHEBI:80716) is a aplysiatoxins (CHEBI:88051) |
| aplysiatoxin (CHEBI:80716) is a bromophenol (CHEBI:33624) |
| aplysiatoxin (CHEBI:80716) is a cyclic hemiketal (CHEBI:59780) |
| aplysiatoxin (CHEBI:80716) is a ether (CHEBI:25698) |
| aplysiatoxin (CHEBI:80716) is a organic heterotricyclic compound (CHEBI:26979) |
| aplysiatoxin (CHEBI:80716) is a secondary alcohol (CHEBI:35681) |
| aplysiatoxin (CHEBI:80716) is a spiroketal (CHEBI:72600) |
| Synonyms | Source |
|---|---|
| (1S,3R,4S,9R,13S,14R)-3-[(2S,5S)-5-(2-bromo-5-hydroxyphenyl)-5-methoxypentan-2-yl]-13-hydroxy-9-[(1R)-1-hydroxyethyl]-4,14,16,16-tetramethyl-2,6,10,17-tetraoxatricyclo[11.3.1.11,5]octadecane-7,11-dione | IUPAC |
| ATX | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| Aplysiatoxin | Wikipedia |
| C16769 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4628307 | Reaxys |
| CAS:52659-57-1 | KEGG COMPOUND |
| CAS:52659-57-1 | ChemIDplus |
| Citations |
|---|