EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H25NO6 |
| Net Charge | 0 |
| Average Mass | 399.443 |
| Monoisotopic Mass | 399.16819 |
| SMILES | COc1cc2c(c(OC)c1OC)-c1ccc(OC)c(=O)cc1[C@@H](N(C)C=O)CC2 |
| InChI | InChI=1S/C22H25NO6/c1-23(12-24)16-8-6-13-10-19(27-3)21(28-4)22(29-5)20(13)14-7-9-18(26-2)17(25)11-15(14)16/h7,9-12,16H,6,8H2,1-5H3/t16-/m0/s1 |
| InChIKey | HTWMEJLBEVTMMZ-INIZCTEOSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-Formyldemecolcine (CHEBI:80675) is a acetamides (CHEBI:22160) |
| N-Formyldemecolcine (CHEBI:80675) is a alkaloid (CHEBI:22315) |
| N-Formyldemecolcine (CHEBI:80675) is a carbotricyclic compound (CHEBI:38032) |
| Manual Xrefs | Databases |
|---|---|
| C16710 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| CAS:14686-61-4 | KEGG COMPOUND |