EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H15NO |
| Net Charge | 0 |
| Average Mass | 177.247 |
| Monoisotopic Mass | 177.11536 |
| SMILES | CC1NCCOC1c1ccccc1 |
| InChI | InChI=1S/C11H15NO/c1-9-11(13-8-7-12-9)10-5-3-2-4-6-10/h2-6,9,11-12H,7-8H2,1H3 |
| InChIKey | OOBHFESNSZDWIU-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. sympathomimetic agent A drug that mimics the effects of stimulating postganglionic adrenergic sympathetic nerves. Included in this class are drugs that directly stimulate adrenergic receptors and drugs that act indirectly by provoking the release of adrenergic transmitters. |
| Application: | sympathomimetic agent A drug that mimics the effects of stimulating postganglionic adrenergic sympathetic nerves. Included in this class are drugs that directly stimulate adrenergic receptors and drugs that act indirectly by provoking the release of adrenergic transmitters. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| phenmetrazine (CHEBI:8067) has functional parent morpholine (CHEBI:34856) |
| phenmetrazine (CHEBI:8067) has role metabolite (CHEBI:25212) |
| phenmetrazine (CHEBI:8067) has role sympathomimetic agent (CHEBI:35524) |
| phenmetrazine (CHEBI:8067) is a morpholines (CHEBI:38785) |
| IUPAC Name |
|---|
| 3-methyl-2-phenylmorpholine |
| Synonym | Source |
|---|---|
| 2-Phenyl-3-Methylmorpholine | DrugBank |
| Manual Xrefs | Databases |
|---|---|
| 2133 | DrugCentral |
| C07432 | KEGG COMPOUND |
| DB00830 | DrugBank |
| HMDB0014968 | HMDB |
| Phenmetrazine | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:140490 | Reaxys |
| CAS:134-49-6 | ChemIDplus |
| CAS:134-49-6 | KEGG COMPOUND |
| Citations |
|---|