EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H22N2O8 |
| Net Charge | 0 |
| Average Mass | 310.303 |
| Monoisotopic Mass | 310.13762 |
| SMILES | NC(=O)CC[C@H](NC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO)C(=O)O |
| InChI | InChI=1S/C11H22N2O8/c12-8(17)2-1-5(11(20)21)13-3-6(15)9(18)10(19)7(16)4-14/h5-7,9-10,13-16,18-19H,1-4H2,(H2,12,17)(H,20,21)/t5-,6+,7+,9+,10+/m0/s1 |
| InChIKey | VPRLICVDSGMIKO-SZWOQXJISA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| mannopine (CHEBI:80662) has functional parent D-mannitol (CHEBI:16899) |
| mannopine (CHEBI:80662) has role plant metabolite (CHEBI:76924) |
| mannopine (CHEBI:80662) is a L-glutamine derivative (CHEBI:24317) |
| mannopine (CHEBI:80662) is a amino acid opine (CHEBI:83229) |
| mannopine (CHEBI:80662) is a dicarboxylic acid monoamide (CHEBI:35735) |
| mannopine (CHEBI:80662) is a hexitol derivative (CHEBI:63430) |
| mannopine (CHEBI:80662) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| mannopine (CHEBI:80662) is a secondary amino compound (CHEBI:50995) |
| IUPAC Name |
|---|
| N2-(1'-deoxy-D-mannitol-1'-yl)-L-glutamine |
| Synonyms | Source |
|---|---|
| 1-{[(1S)-4-amino-1-carboxy-4-oxobutyl]amino}-1-deoxy-D-mannitol | IUPAC |
| Nα-(1-D-mannityl)-L-glutamine | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C16692 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5081463 | Reaxys |
| CAS:87084-52-4 | KEGG COMPOUND |
| CAS:87084-52-4 | ChemIDplus |
| Citations |
|---|