EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H15N5 |
| Net Charge | 0 |
| Average Mass | 205.265 |
| Monoisotopic Mass | 205.13275 |
| SMILES | N=C(N)NC(=N)NCCc1ccccc1 |
| InChI | InChI=1S/C10H15N5/c11-9(12)15-10(13)14-7-6-8-4-2-1-3-5-8/h1-5H,6-7H2,(H6,11,12,13,14,15) |
| InChIKey | ICFJFFQQTFMIBG-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Applications: | hypoglycemic agent A drug which lowers the blood glucose level. geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. hypoglycemic agent A drug which lowers the blood glucose level. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| phenformin (CHEBI:8064) has functional parent biguanide (CHEBI:3095) |
| phenformin (CHEBI:8064) has role antineoplastic agent (CHEBI:35610) |
| phenformin (CHEBI:8064) has role geroprotector (CHEBI:176497) |
| phenformin (CHEBI:8064) has role hypoglycemic agent (CHEBI:35526) |
| phenformin (CHEBI:8064) is a biguanides (CHEBI:53662) |
| IUPAC Name |
|---|
| N-(2-phenylethyl)imidodicarbonimidic diamide |
| INNs | Source |
|---|---|
| fenformina | ChemIDplus |
| phenformin | ChemIDplus |
| phenformine | ChemIDplus |
| phenforminum | ChemIDplus |
| Synonym | Source |
|---|---|
| DBI | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| 2126 | DrugCentral |
| 8CV | PDBeChem |
| C07673 | KEGG COMPOUND |
| D08351 | KEGG DRUG |
| DB00914 | DrugBank |
| HMDB0015050 | HMDB |
| LSM-2233 | LINCS |
| Phenformin | Wikipedia |
| US2961377 | Patent |
| US3057780 | Patent |
| WO2010114805 | Patent |
| Citations |
|---|