EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H13NO2 |
| Net Charge | 0 |
| Average Mass | 131.175 |
| Monoisotopic Mass | 131.09463 |
| SMILES | CCN(CC)CC(=O)O |
| InChI | InChI=1S/C6H13NO2/c1-3-7(4-2)5-6(8)9/h3-5H2,1-2H3,(H,8,9) |
| InChIKey | SGXDXUYKISDCAZ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N,N-diethylglycine (CHEBI:80633) has role drug metabolite (CHEBI:49103) |
| N,N-diethylglycine (CHEBI:80633) is a N-alkylglycine (CHEBI:66933) |
| IUPAC Name |
|---|
| N,N-diethylglycine |
| Synonyms | Source |
|---|---|
| N,N-diethylaminoacetic acid | ChEBI |
| 2-(diethylamino)acetic acid | ChEBI |
| (diethylamino)acetic acid | ChEBI |
| Citations |
|---|