EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H16O4 |
| Net Charge | 0 |
| Average Mass | 284.311 |
| Monoisotopic Mass | 284.10486 |
| SMILES | O=C(/C=C/c1ccc(O)c(O)c1)OCCc1ccccc1 |
| InChI | InChI=1S/C17H16O4/c18-15-8-6-14(12-16(15)19)7-9-17(20)21-11-10-13-4-2-1-3-5-13/h1-9,12,18-19H,10-11H2/b9-7+ |
| InChIKey | SWUARLUWKZWEBQ-VQHVLOKHSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. antiviral agent A substance that destroys or inhibits replication of viruses. immunomodulator Biologically active substance whose activity affects or plays a role in the functioning of the immune system. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. immunomodulator Biologically active substance whose activity affects or plays a role in the functioning of the immune system. neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| phenethyl caffeate (CHEBI:8062) has role anti-inflammatory agent (CHEBI:67079) |
| phenethyl caffeate (CHEBI:8062) has role antibacterial agent (CHEBI:33282) |
| phenethyl caffeate (CHEBI:8062) has role antineoplastic agent (CHEBI:35610) |
| phenethyl caffeate (CHEBI:8062) has role antioxidant (CHEBI:22586) |
| phenethyl caffeate (CHEBI:8062) has role antiviral agent (CHEBI:22587) |
| phenethyl caffeate (CHEBI:8062) has role immunomodulator (CHEBI:50846) |
| phenethyl caffeate (CHEBI:8062) has role metabolite (CHEBI:25212) |
| phenethyl caffeate (CHEBI:8062) has role neuroprotective agent (CHEBI:63726) |
| phenethyl caffeate (CHEBI:8062) is a alkyl caffeate ester (CHEBI:65331) |
| IUPAC Name |
|---|
| 2-phenylethyl (2E)-3-(3,4-dihydroxyphenyl)prop-2-enoate |
| Synonyms | Source |
|---|---|
| 2-phenylethyl (2E)-3-(3,4-dihydroxyphenyl)acrylate | IUPAC |
| 2-phenylethyl caffeate | ChEBI |
| Caffeic acid phenethyl ester | KEGG COMPOUND |
| CAPE | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C00002766 | KNApSAcK |
| C10484 | KEGG COMPOUND |
| Caffeic_acid_phenethyl_ester | Wikipedia |
| QAP | PDBeChem |
| US2008167277 | Patent |
| WO2008006070 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4752508 | Reaxys |
| CAS:104594-70-9 | KEGG COMPOUND |
| CAS:115610-29-2 | ChemIDplus |
| Citations |
|---|