EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H16O4 |
| Net Charge | 0 |
| Average Mass | 284.311 |
| Monoisotopic Mass | 284.10486 |
| SMILES | O=C(/C=C/c1ccc(O)c(O)c1)OCCc1ccccc1 |
| InChI | InChI=1S/C17H16O4/c18-15-8-6-14(12-16(15)19)7-9-17(20)21-11-10-13-4-2-1-3-5-13/h1-9,12,18-19H,10-11H2/b9-7+ |
| InChIKey | SWUARLUWKZWEBQ-VQHVLOKHSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. antiviral agent A substance that destroys or inhibits replication of viruses. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. immunomodulator Biologically active substance whose activity affects or plays a role in the functioning of the immune system. |
| Applications: | anti-inflammatory agent Any compound that has anti-inflammatory effects. neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. immunomodulator Biologically active substance whose activity affects or plays a role in the functioning of the immune system. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| phenethyl caffeate (CHEBI:8062) has role anti-inflammatory agent (CHEBI:67079) |
| phenethyl caffeate (CHEBI:8062) has role antibacterial agent (CHEBI:33282) |
| phenethyl caffeate (CHEBI:8062) has role antineoplastic agent (CHEBI:35610) |
| phenethyl caffeate (CHEBI:8062) has role antioxidant (CHEBI:22586) |
| phenethyl caffeate (CHEBI:8062) has role antiviral agent (CHEBI:22587) |
| phenethyl caffeate (CHEBI:8062) has role immunomodulator (CHEBI:50846) |
| phenethyl caffeate (CHEBI:8062) has role metabolite (CHEBI:25212) |
| phenethyl caffeate (CHEBI:8062) has role neuroprotective agent (CHEBI:63726) |
| phenethyl caffeate (CHEBI:8062) is a alkyl caffeate ester (CHEBI:65331) |
| IUPAC Name |
|---|
| 2-phenylethyl (2E)-3-(3,4-dihydroxyphenyl)prop-2-enoate |
| Synonyms | Source |
|---|---|
| Caffeic acid phenethyl ester | KEGG COMPOUND |
| 2-phenylethyl caffeate | ChEBI |
| 2-phenylethyl (2E)-3-(3,4-dihydroxyphenyl)acrylate | IUPAC |
| CAPE | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C10484 | KEGG COMPOUND |
| QAP | PDBeChem |
| US2008167277 | Patent |
| WO2008006070 | Patent |
| Caffeic_acid_phenethyl_ester | Wikipedia |
| C00002766 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4752508 | Reaxys |
| CAS:104594-70-9 | KEGG COMPOUND |
| CAS:115610-29-2 | ChemIDplus |
| Citations |
|---|