EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H27NO9 |
| Net Charge | 0 |
| Average Mass | 461.467 |
| Monoisotopic Mass | 461.16858 |
| SMILES | [H][C@@]12C=C[C@H](O[C@@H]3O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]3O)[C@@H]3Oc4c(O)ccc5c4[C@@]31CCN(C)[C@@H]2C5 |
| InChI | InChI=1S/C23H27NO9/c1-24-7-6-23-10-3-5-13(31-22-17(28)15(26)16(27)19(33-22)21(29)30)20(23)32-18-12(25)4-2-9(14(18)23)8-11(10)24/h2-5,10-11,13,15-17,19-20,22,25-28H,6-8H2,1H3,(H,29,30)/t10-,11+,13-,15-,16-,17+,19-,20-,22+,23-/m0/s1 |
| InChIKey | GNJCUHZOSOYIEC-GAROZEBRSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Morphine-6-glucuronide (CHEBI:80581) is a morphinane alkaloid (CHEBI:25418) |
| Incoming Relation(s) |
| morphine 6-O-beta-D-glucuronide zwitterion (CHEBI:760566) is tautomer of Morphine-6-glucuronide (CHEBI:80581) |
| INNs | Source |
|---|---|
| glucuronide de morphine | WHO MedNet |
| glucuronido de morfina | WHO MedNet |
| morphine glucuronide | WHO MedNet |
| Synonyms | Source |
|---|---|
| Morphine 6-.beta.-d-glucuronide | ChEMBL |
| Morphine 6-glucuronide | ChEMBL |
| Morphine-6-glucuronide | ChEMBL |
| Morphine 6-glucuronide(minor) | ChEMBL |
| morphine glucuronide | ChEMBL |
| Morphine glucuronide, (-)- | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| C16578 | KEGG COMPOUND |
| HMDB0041937 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:20290-10-2 | KEGG COMPOUND |
| Citations |
|---|