EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H25N |
| Net Charge | 0 |
| Average Mass | 243.394 |
| Monoisotopic Mass | 243.19870 |
| SMILES | c1ccc(C2(N3CCCCC3)CCCCC2)cc1 |
| InChI | InChI=1S/C17H25N/c1-4-10-16(11-5-1)17(12-6-2-7-13-17)18-14-8-3-9-15-18/h1,4-5,10-11H,2-3,6-9,12-15H2 |
| InChIKey | JTJMJGYZQZDUJJ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | neurotoxin A poison that interferes with the functions of the nervous system. NMDA receptor antagonist Any substance that inhibits the action of N-methyl-D-aspartate (NMDA) receptors. They tend to induce a state known as dissociative anesthesia, marked by catalepsy, amnesia, and analgesia, while side effects can include hallucinations, nightmares, and confusion. Due to their psychotomimetic effects, many NMDA receptor antagonists are used as recreational drugs. |
| Applications: | anaesthetic Substance which produces loss of feeling or sensation. psychotropic drug A loosely defined grouping of drugs that have effects on psychological function. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| phencyclidine (CHEBI:8058) has parent hydride piperidine (CHEBI:18049) |
| phencyclidine (CHEBI:8058) has role anaesthetic (CHEBI:38867) |
| phencyclidine (CHEBI:8058) has role neurotoxin (CHEBI:50910) |
| phencyclidine (CHEBI:8058) has role NMDA receptor antagonist (CHEBI:60643) |
| phencyclidine (CHEBI:8058) has role psychotropic drug (CHEBI:35471) |
| phencyclidine (CHEBI:8058) is a benzenes (CHEBI:22712) |
| phencyclidine (CHEBI:8058) is a piperidines (CHEBI:26151) |
| IUPAC Name |
|---|
| 1-(1-phenylcyclohexyl)piperidine |
| INNs | Source |
|---|---|
| fenciclidina | ChemIDplus |
| phencyclidine | ChemIDplus |
| phencyclidinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| PCP | ChemIDplus |
| Phencyclidine | KEGG COMPOUND |
| Citations |
|---|