EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H27NO2 |
| Net Charge | 0 |
| Average Mass | 373.496 |
| Monoisotopic Mass | 373.20418 |
| SMILES | CC/C(=C(\c1ccc(O)cc1)c1ccc(OCCNC)cc1)c1ccccc1 |
| InChI | InChI=1S/C25H27NO2/c1-3-24(19-7-5-4-6-8-19)25(20-9-13-22(27)14-10-20)21-11-15-23(16-12-21)28-18-17-26-2/h4-16,26-27H,3,17-18H2,1-2H3/b25-24- |
| InChIKey | MHJBZVSGOZTKRH-IZHYLOQSSA-N |
| Roles Classification |
|---|
| Applications: | antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-Hydroxy-N-desmethyltamoxifen (CHEBI:80555) has role antineoplastic agent (CHEBI:35610) |
| 4-Hydroxy-N-desmethyltamoxifen (CHEBI:80555) has role antipsychotic agent (CHEBI:35476) |
| 4-Hydroxy-N-desmethyltamoxifen (CHEBI:80555) is a stilbenoid (CHEBI:26776) |
| Synonyms | Source |
|---|---|
| 4-hydroxy-n-desmethyltamoxifen | ChEMBL |
| endoxifen | ChEMBL |
| Endoxifen | KEGG COMPOUND |
| N-desmethyl-4-hydroxytamoxifen | ChEMBL |
| NSC-749798 | ChEMBL |
| Z-endoxifen | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| C16547 | KEGG COMPOUND |
| HMDB0060666 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:112093-28-4 | KEGG COMPOUND |
| Citations |
|---|