EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H15N3O3S |
| Net Charge | 0 |
| Average Mass | 293.348 |
| Monoisotopic Mass | 293.08341 |
| SMILES | N[C@@H](CS/C(Cc1cnc2ccccc12)=N\O)C(=O)O |
| InChI | InChI=1S/C13H15N3O3S/c14-10(13(17)18)7-20-12(16-19)5-8-6-15-11-4-2-1-3-9(8)11/h1-4,6,10,15,19H,5,7,14H2,(H,17,18)/b16-12-/t10-/m0/s1 |
| InChIKey | GREVXYZKHGJYAU-HPCMQXCGSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| S-(Indolylmethylthiohydroximoyl)-L-cysteine (CHEBI:80546) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| Manual Xrefs | Databases |
|---|---|
| C16518 | KEGG COMPOUND |