EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H44O4 |
| Net Charge | 0 |
| Average Mass | 432.645 |
| Monoisotopic Mass | 432.32396 |
| SMILES | [H][C@@]12C[C@@H](O)CC[C@]1(C)[C@@]1([H])CC[C@@]3(C)[C@@](O)(CC[C@]3([H])[C@H](C)CCCC(C)(C)O)C1=CC2=O |
| InChI | InChI=1S/C27H44O4/c1-17(7-6-11-24(2,3)30)19-10-14-27(31)21-16-23(29)22-15-18(28)8-12-25(22,4)20(21)9-13-26(19,27)5/h16-20,22,28,30-31H,6-15H2,1-5H3/t17-,18+,19-,20+,22+,25-,26-,27-/m1/s1 |
| InChIKey | CRCTVUFFBCIURJ-DJHAZVFJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Manduca sexta (ncbitaxon:7130) | - | PubMed (16345130) | |
| Polypodium vulgare (ncbitaxon:58048) | - | PubMed (10561604) |
| Roles Classification |
|---|
| Biological Roles: | animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,22-dideoxyecdysone (CHEBI:80530) has parent hydride 5β-cholestane (CHEBI:35517) |
| 2,22-dideoxyecdysone (CHEBI:80530) has role animal metabolite (CHEBI:75767) |
| 2,22-dideoxyecdysone (CHEBI:80530) has role plant metabolite (CHEBI:76924) |
| 2,22-dideoxyecdysone (CHEBI:80530) is a 14α-hydroxy steroid (CHEBI:36861) |
| 2,22-dideoxyecdysone (CHEBI:80530) is a 25-hydroxy steroid (CHEBI:36864) |
| 2,22-dideoxyecdysone (CHEBI:80530) is a 3β-hydroxy steroid (CHEBI:36836) |
| 2,22-dideoxyecdysone (CHEBI:80530) is a 6-oxo steroid (CHEBI:36883) |
| 2,22-dideoxyecdysone (CHEBI:80530) is a C27-steroid (CHEBI:131619) |
| 2,22-dideoxyecdysone (CHEBI:80530) is a enone (CHEBI:51689) |
| IUPAC Name |
|---|
| 3β,14,25-trihydroxy-5β-cholest-7-en-6-one |
| Synonyms | Source |
|---|---|
| 2,22-bisdeoxyecdysone | LIPID MAPS |
| 2,22dE | ChEBI |
| 3β,14α,25-trihydroxy-5β-cholest-7-en-6-one | LIPID MAPS |
| 3β,5β-ketotriol | ChEBI |
| 3β5β-KT | ChEBI |
| UniProt Name | Source |
|---|---|
| 2,22-dideoxyecdysone | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C16494 | KEGG COMPOUND |
| CPD-15498 | MetaCyc |
| LMST01010561 | LIPID MAPS |
| Citations |
|---|