EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H22O10 |
| Net Charge | 0 |
| Average Mass | 434.397 |
| Monoisotopic Mass | 434.12130 |
| SMILES | O=C1C[C@@H](c2ccc(O)cc2)Oc2c1c(O)cc(O)c2[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C21H22O10/c22-7-14-17(27)18(28)19(29)21(31-14)16-11(25)5-10(24)15-12(26)6-13(30-20(15)16)8-1-3-9(23)4-2-8/h1-5,13-14,17-19,21-25,27-29H,6-7H2/t13-,14+,17+,18-,19+,21-/m0/s1 |
| InChIKey | VPQWOQSQAVBHEV-VHLXACGYSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| isohemiphloin (CHEBI:80529) has functional parent (S)-naringenin (CHEBI:17846) |
| isohemiphloin (CHEBI:80529) has role plant metabolite (CHEBI:76924) |
| isohemiphloin (CHEBI:80529) is a (2S)-flavan-4-one (CHEBI:140377) |
| isohemiphloin (CHEBI:80529) is a C-glycosyl compound (CHEBI:20857) |
| isohemiphloin (CHEBI:80529) is a 4'-hydroxyflavanones (CHEBI:140331) |
| isohemiphloin (CHEBI:80529) is a trihydroxyflavanone (CHEBI:38739) |
| IUPAC Name |
|---|
| (1S)-1,5-anhydro-1-[(2S)-5,7-dihydroxy-2-(4-hydroxyphenyl)-4-oxo-3,4-dihydro-2H-1-benzopyran-8-yl]-D-glucitol |
| Synonyms | Source |
|---|---|
| (S)-8-β-D-glucopyranosyl-4',5,7-trihydroxyflavanone | ChEBI |
| 8-C-Glucosylnaringenin | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C16492 | KEGG COMPOUND |
| C00006092 | KNApSAcK |
| LMPK12140224 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:23194299 | Reaxys |
| Citations |
|---|