EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H30O16 |
| Net Charge | 0 |
| Average Mass | 610.521 |
| Monoisotopic Mass | 610.15338 |
| SMILES | O=c1c(O[C@@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)c(-c2ccc(O)cc2)oc2cc(O)cc(O)c12 |
| InChI | InChI=1S/C27H30O16/c28-7-14-17(33)20(36)22(38)26(40-14)43-25-21(37)18(34)15(8-29)41-27(25)42-24-19(35)16-12(32)5-11(31)6-13(16)39-23(24)9-1-3-10(30)4-2-9/h1-6,14-15,17-18,20-22,25-34,36-38H,7-8H2/t14-,15-,17-,18+,20+,21+,22-,25-,26+,27+/m1/s1 |
| InChIKey | LKZDFKLGDGSGEO-PABQPRPFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Panax japonicus var. bipinnatifidus (ncbitaxon:45211) | leaf (BTO:0000713) | PubMed (2618703) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| kaempferol 3-O-β-D-glucosylgalactoside (CHEBI:80528) has functional parent kaempferol (CHEBI:28499) |
| kaempferol 3-O-β-D-glucosylgalactoside (CHEBI:80528) has role plant metabolite (CHEBI:76924) |
| kaempferol 3-O-β-D-glucosylgalactoside (CHEBI:80528) is a disaccharide derivative (CHEBI:63353) |
| kaempferol 3-O-β-D-glucosylgalactoside (CHEBI:80528) is a glycosyloxyflavone (CHEBI:50018) |
| kaempferol 3-O-β-D-glucosylgalactoside (CHEBI:80528) is a trihydroxyflavone (CHEBI:27116) |
| IUPAC Name |
|---|
| 5,7-dihydroxy-2-(4-hydroxyphenyl)-4-oxo-4H-1-benzopyran-3-yl 2-O-β-D-glucopyranosyl-β-D-galactopyranoside |
| Synonym | Source |
|---|---|
| panasenoside | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C16490 | KEGG COMPOUND |
| C00005157 | KNApSAcK |
| LMPK12111666 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6259840 | Reaxys |
| Citations |
|---|