EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H5FO4 |
| Net Charge | 0 |
| Average Mass | 160.100 |
| Monoisotopic Mass | 160.01719 |
| SMILES | O=C(O)/C=C\C(F)=C/C(=O)O |
| InChI | InChI=1S/C6H5FO4/c7-4(3-6(10)11)1-2-5(8)9/h1-3H,(H,8,9)(H,10,11)/b2-1-,4-3+ |
| InChIKey | OZSAECPLLVFZIE-BXTBVDPRSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-Fluoro-cis,cis-muconate (CHEBI:80516) is a halo fatty acid (CHEBI:60692) |
| Manual Xrefs | Databases |
|---|---|
| C16474 | KEGG COMPOUND |