EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H12N2 |
| Net Charge | 0 |
| Average Mass | 184.242 |
| Monoisotopic Mass | 184.10005 |
| SMILES | Nc1ccc(-c2ccc(N)cc2)cc1 |
| InChI | InChI=1S/C12H12N2/c13-11-5-1-9(2-6-11)10-3-7-12(14)8-4-10/h1-8H,13-14H2 |
| InChIKey | HFACYLZERDEVSX-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| benzidine (CHEBI:80495) has role carcinogenic agent (CHEBI:50903) |
| benzidine (CHEBI:80495) is a biphenyls (CHEBI:22888) |
| benzidine (CHEBI:80495) is a substituted aniline (CHEBI:48975) |
| IUPAC Name |
|---|
| biphenyl-4,4'-diamine |
| Synonyms | Source |
|---|---|
| 4,4'-biphenyldiamine | ChemIDplus |
| 4,4'-diphenylenediamine | ChemIDplus |
| 4,4'-diaminobiphenyl | ChemIDplus |
| (1,1'-biphenyl)-4,4'-diamine | ChemIDplus |
| 4,4'-diamino-1,1'-biphenyl | ChemIDplus |
| 4,4'-biphenylenediamine | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C16444 | KEGG COMPOUND |
| HMDB0041835 | HMDB |
| Benzidine | Wikipedia |
| Citations |
|---|