EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H14O4 |
| Net Charge | 0 |
| Average Mass | 270.284 |
| Monoisotopic Mass | 270.08921 |
| SMILES | COc1cc(O)c2c(c1)O[C@H](c1ccccc1)CC2=O |
| InChI | InChI=1S/C16H14O4/c1-19-11-7-12(17)16-13(18)9-14(20-15(16)8-11)10-5-3-2-4-6-10/h2-8,14,17H,9H2,1H3/t14-/m0/s1 |
| InChIKey | ORJDDOBAOGKRJV-AWEZNQCLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cajanus cajan (ncbitaxon:3821) | leaf (BTO:0000713) | PubMed (24680612) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | antidote Any protective agent counteracting or neutralizing the action of poisons. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pinostrobin (CHEBI:80491) has functional parent (2S)-flavanone (CHEBI:15606) |
| pinostrobin (CHEBI:80491) has role antidote (CHEBI:50247) |
| pinostrobin (CHEBI:80491) has role plant metabolite (CHEBI:76924) |
| pinostrobin (CHEBI:80491) is a monohydroxyflavanone (CHEBI:38748) |
| pinostrobin (CHEBI:80491) is a monomethoxyflavanone (CHEBI:38738) |
| IUPAC Name |
|---|
| (2S)-5-hydroxy-7-methoxy-2-phenyl-2,3-dihydro-4H-1-benzopyran-4-one |
| Synonyms | Source |
|---|---|
| (2S)-5-hydroxy-7-methoxyflavanone | ChEBI |
| dihydrotectochrysin | ChEBI |
| Pinocembrin-7-methylether | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C00008144 | KNApSAcK |
| C16419 | KEGG COMPOUND |
| LMPK12140216 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:90359 | Reaxys |
| CAS:480-37-5 | KEGG COMPOUND |
| CAS:480-37-5 | ChemIDplus |
| Citations |
|---|