EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H14O6 |
| Net Charge | 0 |
| Average Mass | 302.282 |
| Monoisotopic Mass | 302.07904 |
| SMILES | COc1cc(/C=C/C(=O)c2c(O)cc(O)cc2O)ccc1O |
| InChI | InChI=1S/C16H14O6/c1-22-15-6-9(2-4-11(15)18)3-5-12(19)16-13(20)7-10(17)8-14(16)21/h2-8,17-18,20-21H,1H3/b5-3+ |
| InChIKey | WQWVIIRCVOZVPN-HWKANZROSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| homoeriodictyol chalcone (CHEBI:80485) has functional parent trans-chalcone (CHEBI:48965) |
| homoeriodictyol chalcone (CHEBI:80485) has role plant metabolite (CHEBI:76924) |
| homoeriodictyol chalcone (CHEBI:80485) is a benzenetriol (CHEBI:22707) |
| homoeriodictyol chalcone (CHEBI:80485) is a chalcones (CHEBI:23086) |
| homoeriodictyol chalcone (CHEBI:80485) is a guaiacols (CHEBI:134251) |
| IUPAC Name |
|---|
| (2E)-3-(4-hydroxy-3-methoxyphenyl)-1-(2,4,6-trihydroxyphenyl)prop-2-en-1-one |
| Synonyms | Source |
|---|---|
| 4,2',4',6'-tetrahydroxy-3-methoxychalcone | ChEBI |
| 4,2',4',6'-tetrahydroxy-3-methoxy-trans-chalcone | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C00006974 | KNApSAcK |
| C16405 | KEGG COMPOUND |
| LMPK12120274 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2297246 | Reaxys |