EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H12O4 |
| Net Charge | 0 |
| Average Mass | 256.257 |
| Monoisotopic Mass | 256.07356 |
| SMILES | O=C(/C=C/c1ccccc1)c1c(O)cc(O)cc1O |
| InChI | InChI=1S/C15H12O4/c16-11-8-13(18)15(14(19)9-11)12(17)7-6-10-4-2-1-3-5-10/h1-9,16,18-19H/b7-6+ |
| InChIKey | LOYXTWZXLWHMBX-VOTSOKGWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Piper lanceaefolium (ncbitaxon:538291) | leaf (BTO:0000713) | PubMed (11809068) |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pinocembrin chalcone (CHEBI:80484) has functional parent trans-chalcone (CHEBI:48965) |
| pinocembrin chalcone (CHEBI:80484) has role antifungal agent (CHEBI:35718) |
| pinocembrin chalcone (CHEBI:80484) has role plant metabolite (CHEBI:76924) |
| pinocembrin chalcone (CHEBI:80484) is a chalcones (CHEBI:23086) |
| IUPAC Name |
|---|
| (2E)-3-phenyl-1-(2,4,6-trihydroxyphenyl)prop-2-en-1-one |
| Synonym | Source |
|---|---|
| 2',4',6'-trihydroxychalcone | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C00006933 | KNApSAcK |
| C16404 | KEGG COMPOUND |
| LMPK12120243 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1884469 | Reaxys |
| Citations |
|---|