EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H32N9O8PS |
| Net Charge | 0 |
| Average Mass | 517.506 |
| Monoisotopic Mass | 517.18322 |
| SMILES | C[C@H](NC(=O)[C@@H](N)CCCNP(N)(=O)NS(=O)(=O)O)C(=O)N[C@@H](CCCNC(=N)N)C(=O)O |
| InChI | InChI=1S/C14H32N9O8PS/c1-8(11(24)22-10(13(26)27)5-3-6-19-14(16)17)21-12(25)9(15)4-2-7-20-32(18,28)23-33(29,30)31/h8-10H,2-7,15H2,1H3,(H,21,25)(H,22,24)(H,26,27)(H4,16,17,19)(H,29,30,31)(H4,18,20,23,28)/t8-,9-,10-,32?/m0/s1 |
| InChIKey | JXFJDYCRCSOLAG-SKTDGYGZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pseudomonas syringae (ncbitaxon:317) | |||
| - | DOI (10.1016/0040-4039(84)80033-7) | ||
| - | Article (J. Gen. Plant Pathol., 2018, 84, 137-141) | Strain: Pseudomonas syringae pv. phaseolicola NPS312 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. EC 2.1.3.3 (ornithine carbamoyltransferase) inhibitor Any EC 2.1.3.* (carboxy- and carbamoyltransferases) inhibitor that inhibits the action of ornithine carbamoyltransferase (EC 2.1.3.3). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| phaseolotoxin (CHEBI:8047) has functional parent sulfamic acid (CHEBI:9330) |
| phaseolotoxin (CHEBI:8047) has role antineoplastic agent (CHEBI:35610) |
| phaseolotoxin (CHEBI:8047) has role bacterial metabolite (CHEBI:76969) |
| phaseolotoxin (CHEBI:8047) has role EC 2.1.3.3 (ornithine carbamoyltransferase) inhibitor (CHEBI:143003) |
| phaseolotoxin (CHEBI:8047) is a guanidines (CHEBI:24436) |
| phaseolotoxin (CHEBI:8047) is a tripeptide (CHEBI:47923) |
| IUPAC Name |
|---|
| N5-[amino(sulfoamino)phosphoryl]-L-ornithyl-L-alanyl-L-arginine |
| Synonyms | Source |
|---|---|
| N5-[amino(sulfoamino)phosphinyl]-L-ornithyl-L-alanyl-N6-(aminoiminomethyl)-L-lysine | KEGG COMPOUND |
| Nδ-(N'-sulphodiaminophosphinyl)-ornithyl-alanyl-homoarginine | ChemIDplus |
| phaseolotoxin A | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| CAS:62249-77-8 | KEGG COMPOUND |
| CAS:62249-77-8 | ChemIDplus |
| Citations |
|---|