EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:80427 - 7,8-dihydro-β-carotene
| Formula | C40H58 |
| Net Charge | 0 |
| Average Mass | 538.904 |
| Monoisotopic Mass | 538.45385 |
| SMILES | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C=C/C=C(C)/C=C/C=C(\C)CCC2=C(C)CCCC2(C)C)C(C)(C)CCC1 |
| InChI | InChI=1S/C40H58/c1-31(19-13-21-33(3)25-27-37-35(5)23-15-29-39(37,7)8)17-11-12-18-32(2)20-14-22-34(4)26-28-38-36(6)24-16-30-40(38,9)10/h11-14,17-22,25,27H,15-16,23-24,26,28-30H2,1-10H3/b12-11+,19-13+,20-14+,27-25+,31-17+,32-18+,33-21+,34-22+ |
| InChIKey | ZWHNFQQCBBBUHX-RQJQFHIYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Podospora anserina (ncbitaxon:2587412) | - | PubMed (19277665) | |
| Chlorobium phaeobacteroides (ncbitaxon:1096) | - | PubMed (15115301) | |
| Escherichia coli (ncbitaxon:562) | - | PubMed (20525861) | |
| Silurus asotus (ncbitaxon:30991) | - | PubMed (21212565) |
| Roles Classification |
|---|
| Biological Roles: | marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7,8-dihydro-β-carotene (CHEBI:80427) has parent hydride β-carotene (CHEBI:17579) |
| 7,8-dihydro-β-carotene (CHEBI:80427) has role Escherichia coli metabolite (CHEBI:76971) |
| 7,8-dihydro-β-carotene (CHEBI:80427) has role animal metabolite (CHEBI:75767) |
| 7,8-dihydro-β-carotene (CHEBI:80427) has role bacterial metabolite (CHEBI:76969) |
| 7,8-dihydro-β-carotene (CHEBI:80427) has role fungal metabolite (CHEBI:76946) |
| 7,8-dihydro-β-carotene (CHEBI:80427) has role marine metabolite (CHEBI:76507) |
| 7,8-dihydro-β-carotene (CHEBI:80427) is a carotenoid β-end derivative (CHEBI:139120) |
| 7,8-dihydro-β-carotene (CHEBI:80427) is a cyclic carotene (CHEBI:35163) |
| IUPAC Name |
|---|
| 7,8-dihydro-β,β-carotene |
| Synonym | Source |
|---|---|
| 7,8-dihydro-beta-carotene | LIPID MAPS |
| UniProt Name | Source |
|---|---|
| 7,8-dihydro-β-carotene | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C00023214 | KNApSAcK |
| C16291 | KEGG COMPOUND |
| LMPR01070091 | LIPID MAPS |
| CPD-20647 | MetaCyc |
| 17220905 | ChemSpider |
| Citations |
|---|