EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H26O6 |
| Net Charge | 0 |
| Average Mass | 374.433 |
| Monoisotopic Mass | 374.17294 |
| SMILES | [H][C@]12OC(=O)C(=C)[C@]1([H])[C@@H](OC(=O)C(=C)C)C/C(C)=C\[C@@]1(OCC)C=C(C)[C@]2([H])O1 |
| InChI | InChI=1S/C21H26O6/c1-7-24-21-9-12(4)8-15(25-19(22)11(2)3)16-14(6)20(23)26-18(16)17(27-21)13(5)10-21/h9-10,15-18H,2,6-8H2,1,3-5H3/b12-9-/t15-,16+,17-,18-,21-/m0/s1 |
| InChIKey | YNGLXZUKGYZCFL-YUZMFRNZSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| phantomolin (CHEBI:8041) has role antineoplastic agent (CHEBI:35610) |
| phantomolin (CHEBI:8041) has role metabolite (CHEBI:25212) |
| phantomolin (CHEBI:8041) is a cyclic ether (CHEBI:37407) |
| phantomolin (CHEBI:8041) is a enoate ester (CHEBI:51702) |
| phantomolin (CHEBI:8041) is a germacranolide (CHEBI:73011) |
| phantomolin (CHEBI:8041) is a organic heterotricyclic compound (CHEBI:26979) |
| phantomolin (CHEBI:8041) is a γ-lactone (CHEBI:37581) |
| IUPAC Name |
|---|
| (3aR,4S,6Z,8S,11S,11aS)-8-ethoxy-6,10-dimethyl-3-methylidene-2-oxo-2,3,3a,4,5,8,11,11a-octahydro-8,11-epoxycyclodeca[b]furan-4-yl 2-methylprop-2-enoate |
| Synonym | Source |
|---|---|
| Phantomolin | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1663128 | Reaxys |
| CAS:55306-08-6 | KEGG COMPOUND |
| CAS:55306-08-6 | ChemIDplus |
| Citations |
|---|