EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H5ClO4 |
| Net Charge | 0 |
| Average Mass | 176.555 |
| Monoisotopic Mass | 175.98764 |
| SMILES | O=C/C=C\C(Cl)=C(\O)C(=O)O |
| InChI | InChI=1S/C6H5ClO4/c7-4(2-1-3-8)5(9)6(10)11/h1-3,9H,(H,10,11)/b2-1-,5-4- |
| InChIKey | JLQFJRRWDWBGRV-OIFXTYEKSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-Chloro-2-hydroxymuconic semialdehyde (CHEBI:80409) is a medium-chain fatty acid (CHEBI:59554) |
| Manual Xrefs | Databases |
|---|---|
| C16266 | KEGG COMPOUND |